C31H32N2O7S2 — CID 142536673
[3-[[3-(2,4,6-trimethylphenyl)sulfonyloxyphenyl]carbamoylamino]phenyl] 2,4,6-trimethylbenzenesulfonate (PubChem CID 142536673) has the molecular formula C31H32N2O7S2 and a molecular weight of 608.74 g/mol. Its IUPAC name is [3-[[3-(2,4,6-trimethylphenyl)sulfonyloxyphenyl]carbamoylamino]phenyl] 2,4,6-trimethylbenzenesulfonate.
| Compound Name | [3-[[3-(2,4,6-trimethylphenyl)sulfonyloxyphenyl]carbamoylamino]phenyl] 2,4,6-trimethylbenzenesulfonate |
|---|---|
| PubChem CID | 142536673 |
| Molecular Formula | C31H32N2O7S2 |
| Molecular Weight | 608.74 g/mol |
| Exact Mass | 608.17 |
| IUPAC Name | [3-[[3-(2,4,6-trimethylphenyl)sulfonyloxyphenyl]carbamoylamino]phenyl] 2,4,6-trimethylbenzenesulfonate |
| SMILES | Cc1cc(C)c(S(=O)(=O)Oc2cccc(NC(=O)Nc3cccc(OS(=O)(=O)c4c(C)cc(C)cc4C)c3)c2)c(C)c1 |
| InChI | InChI=1S/C31H32N2O7S2/c1-19-13-21(3)29(22(4)14-19)41(35,36)39-27-11-7-9-25(17-27)32-31(34)33-26-10-8-12-28(18-26)40-42(37,38)30-23(5)15-20(2)16-24(30)6/h7-18H,1-6H3,(H2,32,33,34) |
| InChIKey | SAGXRAVYLUDDBY-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 127.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.74 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|