C29H28N2O7S2 — CID 174187599
[3-[[2-(2,6-dimethylphenyl)sulfonyloxyphenyl]carbamoylamino]phenyl] 2,6-dimethylbenzenesulfonate (PubChem CID 174187599) has the molecular formula C29H28N2O7S2 and a molecular weight of 580.68 g/mol. Its IUPAC name is [3-[[2-(2,6-dimethylphenyl)sulfonyloxyphenyl]carbamoylamino]phenyl] 2,6-dimethylbenzenesulfonate.
| Compound Name | [3-[[2-(2,6-dimethylphenyl)sulfonyloxyphenyl]carbamoylamino]phenyl] 2,6-dimethylbenzenesulfonate |
|---|---|
| PubChem CID | 174187599 |
| Molecular Formula | C29H28N2O7S2 |
| Molecular Weight | 580.68 g/mol |
| Exact Mass | 580.13 |
| IUPAC Name | [3-[[2-(2,6-dimethylphenyl)sulfonyloxyphenyl]carbamoylamino]phenyl] 2,6-dimethylbenzenesulfonate |
| SMILES | Cc1cccc(C)c1S(=O)(=O)Oc1cccc(NC(=O)Nc2ccccc2OS(=O)(=O)c2c(C)cccc2C)c1 |
| InChI | InChI=1S/C29H28N2O7S2/c1-19-10-7-11-20(2)27(19)39(33,34)37-24-15-9-14-23(18-24)30-29(32)31-25-16-5-6-17-26(25)38-40(35,36)28-21(3)12-8-13-22(28)4/h5-18H,1-4H3,(H2,30,31,32) |
| InChIKey | GVLJXGABIWHCMF-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 127.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.68 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|