C26H30N4O8S2 — CID 155661435
[3-[[2-[(3-propan-2-ylsulfonyloxyphenyl)carbamoylamino]phenyl]carbamoylamino]phenyl] propane-2-sulfonate (PubChem CID 155661435) has the molecular formula C26H30N4O8S2 and a molecular weight of 590.68 g/mol. Its IUPAC name is [3-[[2-[(3-propan-2-ylsulfonyloxyphenyl)carbamoylamino]phenyl]carbamoylamino]phenyl] propane-2-sulfonate.
| Compound Name | [3-[[2-[(3-propan-2-ylsulfonyloxyphenyl)carbamoylamino]phenyl]carbamoylamino]phenyl] propane-2-sulfonate |
|---|---|
| PubChem CID | 155661435 |
| Molecular Formula | C26H30N4O8S2 |
| Molecular Weight | 590.68 g/mol |
| Exact Mass | 590.15 |
| IUPAC Name | [3-[[2-[(3-propan-2-ylsulfonyloxyphenyl)carbamoylamino]phenyl]carbamoylamino]phenyl] propane-2-sulfonate |
| SMILES | CC(C)S(=O)(=O)Oc1cccc(NC(=O)Nc2ccccc2NC(=O)Nc2cccc(OS(=O)(=O)C(C)C)c2)c1 |
| InChI | InChI=1S/C26H30N4O8S2/c1-17(2)39(33,34)37-21-11-7-9-19(15-21)27-25(31)29-23-13-5-6-14-24(23)30-26(32)28-20-10-8-12-22(16-20)38-40(35,36)18(3)4/h5-18H,1-4H3,(H2,27,29,31)(H2,28,30,32) |
| InChIKey | GITCZKAGPRCGET-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 169.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.68 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|