C34H30N4O8S2 — CID 155661580
[3-[[2-[(3-benzylsulfonyloxyphenyl)carbamoylamino]phenyl]carbamoylamino]phenyl] phenylmethanesulfonate (PubChem CID 155661580) has the molecular formula C34H30N4O8S2 and a molecular weight of 686.77 g/mol. Its IUPAC name is [3-[[2-[(3-benzylsulfonyloxyphenyl)carbamoylamino]phenyl]carbamoylamino]phenyl] phenylmethanesulfonate.
| Compound Name | [3-[[2-[(3-benzylsulfonyloxyphenyl)carbamoylamino]phenyl]carbamoylamino]phenyl] phenylmethanesulfonate |
|---|---|
| PubChem CID | 155661580 |
| Molecular Formula | C34H30N4O8S2 |
| Molecular Weight | 686.77 g/mol |
| Exact Mass | 686.15 |
| IUPAC Name | [3-[[2-[(3-benzylsulfonyloxyphenyl)carbamoylamino]phenyl]carbamoylamino]phenyl] phenylmethanesulfonate |
| SMILES | O=C(Nc1cccc(OS(=O)(=O)Cc2ccccc2)c1)Nc1ccccc1NC(=O)Nc1cccc(OS(=O)(=O)Cc2ccccc2)c1 |
| InChI | InChI=1S/C34H30N4O8S2/c39-33(35-27-15-9-17-29(21-27)45-47(41,42)23-25-11-3-1-4-12-25)37-31-19-7-8-20-32(31)38-34(40)36-28-16-10-18-30(22-28)46-48(43,44)24-26-13-5-2-6-14-26/h1-22H,23-24H2,(H2,35,37,39)(H2,36,38,40) |
| InChIKey | VSSLVUKCKFFBKF-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 169.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.77 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|