C20H18N2O5S — CID 155234947
[3-[(3-hydroxyphenyl)carbamoylamino]phenyl] phenylmethanesulfonate (PubChem CID 155234947) has the molecular formula C20H18N2O5S and a molecular weight of 398.44 g/mol. Its IUPAC name is [3-[(3-hydroxyphenyl)carbamoylamino]phenyl] phenylmethanesulfonate.
| Compound Name | [3-[(3-hydroxyphenyl)carbamoylamino]phenyl] phenylmethanesulfonate |
|---|---|
| PubChem CID | 155234947 |
| Molecular Formula | C20H18N2O5S |
| Molecular Weight | 398.44 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | [3-[(3-hydroxyphenyl)carbamoylamino]phenyl] phenylmethanesulfonate |
| SMILES | O=C(Nc1cccc(O)c1)Nc1cccc(OS(=O)(=O)Cc2ccccc2)c1 |
| InChI | InChI=1S/C20H18N2O5S/c23-18-10-4-8-16(12-18)21-20(24)22-17-9-5-11-19(13-17)27-28(25,26)14-15-6-2-1-3-7-15/h1-13,23H,14H2,(H2,21,22,24) |
| InChIKey | AQIOZZWJVZDKKF-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.44 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|