C22H22N2O7S2 — CID 142536491
[2-[(3-benzylsulfonyloxyphenyl)carbamoylamino]phenyl] ethanesulfonate (PubChem CID 142536491) has the molecular formula C22H22N2O7S2 and a molecular weight of 490.56 g/mol. Its IUPAC name is [2-[(3-benzylsulfonyloxyphenyl)carbamoylamino]phenyl] ethanesulfonate.
| Compound Name | [2-[(3-benzylsulfonyloxyphenyl)carbamoylamino]phenyl] ethanesulfonate |
|---|---|
| PubChem CID | 142536491 |
| Molecular Formula | C22H22N2O7S2 |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.09 |
| IUPAC Name | [2-[(3-benzylsulfonyloxyphenyl)carbamoylamino]phenyl] ethanesulfonate |
| SMILES | CCS(=O)(=O)Oc1ccccc1NC(=O)Nc1cccc(OS(=O)(=O)Cc2ccccc2)c1 |
| InChI | InChI=1S/C22H22N2O7S2/c1-2-32(26,27)31-21-14-7-6-13-20(21)24-22(25)23-18-11-8-12-19(15-18)30-33(28,29)16-17-9-4-3-5-10-17/h3-15H,2,16H2,1H3,(H2,23,24,25) |
| InChIKey | JAIIJWGTORKZTR-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 127.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|