C17H20N2O7S2 — CID 142536703
[4-[(2-ethylsulfonyloxyphenyl)carbamoylamino]phenyl] ethanesulfonate (PubChem CID 142536703) has the molecular formula C17H20N2O7S2 and a molecular weight of 428.49 g/mol. Its IUPAC name is [4-[(2-ethylsulfonyloxyphenyl)carbamoylamino]phenyl] ethanesulfonate.
| Compound Name | [4-[(2-ethylsulfonyloxyphenyl)carbamoylamino]phenyl] ethanesulfonate |
|---|---|
| PubChem CID | 142536703 |
| Molecular Formula | C17H20N2O7S2 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.07 |
| IUPAC Name | [4-[(2-ethylsulfonyloxyphenyl)carbamoylamino]phenyl] ethanesulfonate |
| SMILES | CCS(=O)(=O)Oc1ccc(NC(=O)Nc2ccccc2OS(=O)(=O)CC)cc1 |
| InChI | InChI=1S/C17H20N2O7S2/c1-3-27(21,22)25-14-11-9-13(10-12-14)18-17(20)19-15-7-5-6-8-16(15)26-28(23,24)4-2/h5-12H,3-4H2,1-2H3,(H2,18,19,20) |
| InChIKey | LISNJSNLPYRJRW-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 127.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|