C30H24N2O7S2 — CID 142536813
[4-[[2-(4-methylphenyl)sulfonyloxyphenyl]carbamoylamino]phenyl] naphthalene-1-sulfonate (PubChem CID 142536813) has the molecular formula C30H24N2O7S2 and a molecular weight of 588.66 g/mol. Its IUPAC name is [4-[[2-(4-methylphenyl)sulfonyloxyphenyl]carbamoylamino]phenyl] naphthalene-1-sulfonate.
| Compound Name | [4-[[2-(4-methylphenyl)sulfonyloxyphenyl]carbamoylamino]phenyl] naphthalene-1-sulfonate |
|---|---|
| PubChem CID | 142536813 |
| Molecular Formula | C30H24N2O7S2 |
| Molecular Weight | 588.66 g/mol |
| Exact Mass | 588.10 |
| IUPAC Name | [4-[[2-(4-methylphenyl)sulfonyloxyphenyl]carbamoylamino]phenyl] naphthalene-1-sulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2ccccc2NC(=O)Nc2ccc(OS(=O)(=O)c3cccc4ccccc34)cc2)cc1 |
| InChI | InChI=1S/C30H24N2O7S2/c1-21-13-19-25(20-14-21)40(34,35)39-28-11-5-4-10-27(28)32-30(33)31-23-15-17-24(18-16-23)38-41(36,37)29-12-6-8-22-7-2-3-9-26(22)29/h2-20H,1H3,(H2,31,32,33) |
| InChIKey | FHEQEBREUVYYGR-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 127.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.66 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|