C21H20N2O7S2 — CID 175961695
[2-[(4-methylsulfonyloxyphenyl)carbamoylamino]phenyl] 4-methylbenzenesulfonate (PubChem CID 175961695) has the molecular formula C21H20N2O7S2 and a molecular weight of 476.53 g/mol. Its IUPAC name is [2-[(4-methylsulfonyloxyphenyl)carbamoylamino]phenyl] 4-methylbenzenesulfonate.
| Compound Name | [2-[(4-methylsulfonyloxyphenyl)carbamoylamino]phenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 175961695 |
| Molecular Formula | C21H20N2O7S2 |
| Molecular Weight | 476.53 g/mol |
| Exact Mass | 476.07 |
| IUPAC Name | [2-[(4-methylsulfonyloxyphenyl)carbamoylamino]phenyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2ccccc2NC(=O)Nc2ccc(OS(C)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C21H20N2O7S2/c1-15-7-13-18(14-8-15)32(27,28)30-20-6-4-3-5-19(20)23-21(24)22-16-9-11-17(12-10-16)29-31(2,25)26/h3-14H,1-2H3,(H2,22,23,24) |
| InChIKey | NVCQUYOUNAQVRN-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 127.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.53 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|