C34H30N4O14S4 — CID 155659665
bis[4-[(4-methylsulfonyloxyphenyl)carbamoylamino]phenyl] benzene-1,3-disulfonate (PubChem CID 155659665) has the molecular formula C34H30N4O14S4 and a molecular weight of 846.90 g/mol. Its IUPAC name is bis[4-[(4-methylsulfonyloxyphenyl)carbamoylamino]phenyl] benzene-1,3-disulfonate.
| Compound Name | bis[4-[(4-methylsulfonyloxyphenyl)carbamoylamino]phenyl] benzene-1,3-disulfonate |
|---|---|
| PubChem CID | 155659665 |
| Molecular Formula | C34H30N4O14S4 |
| Molecular Weight | 846.90 g/mol |
| Exact Mass | 846.06 |
| IUPAC Name | bis[4-[(4-methylsulfonyloxyphenyl)carbamoylamino]phenyl] benzene-1,3-disulfonate |
| SMILES | CS(=O)(=O)Oc1ccc(NC(=O)Nc2ccc(OS(=O)(=O)c3cccc(S(=O)(=O)Oc4ccc(NC(=O)Nc5ccc(OS(C)(=O)=O)cc5)cc4)c3)cc2)cc1 |
| InChI | InChI=1S/C34H30N4O14S4/c1-53(41,42)49-27-14-6-23(7-15-27)35-33(39)37-25-10-18-29(19-11-25)51-55(45,46)31-4-3-5-32(22-31)56(47,48)52-30-20-12-26(13-21-30)38-34(40)36-24-8-16-28(17-9-24)50-54(2,43)44/h3-22H,1-2H3,(H2,35,37,39)(H2,36,38,40) |
| InChIKey | LTSDALOKSMFIKY-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 255.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 846.90 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|