C16H18N2O7S2 — CID 142536657
[4-[(4-methylsulfonyloxyphenyl)carbamoylamino]phenyl] ethanesulfonate (PubChem CID 142536657) has the molecular formula C16H18N2O7S2 and a molecular weight of 414.46 g/mol. Its IUPAC name is [4-[(4-methylsulfonyloxyphenyl)carbamoylamino]phenyl] ethanesulfonate.
| Compound Name | [4-[(4-methylsulfonyloxyphenyl)carbamoylamino]phenyl] ethanesulfonate |
|---|---|
| PubChem CID | 142536657 |
| Molecular Formula | C16H18N2O7S2 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.06 |
| IUPAC Name | [4-[(4-methylsulfonyloxyphenyl)carbamoylamino]phenyl] ethanesulfonate |
| SMILES | CCS(=O)(=O)Oc1ccc(NC(=O)Nc2ccc(OS(C)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C16H18N2O7S2/c1-3-27(22,23)25-15-10-6-13(7-11-15)18-16(19)17-12-4-8-14(9-5-12)24-26(2,20)21/h4-11H,3H2,1-2H3,(H2,17,18,19) |
| InChIKey | FQLKQZVTYVHKCS-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 127.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|