C15H21NO4S — CID 127045881
[4-(cyclohexanecarbonylamino)phenyl] ethanesulfonate (PubChem CID 127045881) has the molecular formula C15H21NO4S and a molecular weight of 311.40 g/mol. Its IUPAC name is [4-(cyclohexanecarbonylamino)phenyl] ethanesulfonate.
| Compound Name | [4-(cyclohexanecarbonylamino)phenyl] ethanesulfonate |
|---|---|
| PubChem CID | 127045881 |
| Molecular Formula | C15H21NO4S |
| Molecular Weight | 311.40 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | [4-(cyclohexanecarbonylamino)phenyl] ethanesulfonate |
| SMILES | CCS(=O)(=O)Oc1ccc(NC(=O)C2CCCCC2)cc1 |
| InChI | InChI=1S/C15H21NO4S/c1-2-21(18,19)20-14-10-8-13(9-11-14)16-15(17)12-6-4-3-5-7-12/h8-12H,2-7H2,1H3,(H,16,17) |
| InChIKey | OANARLBVDCTXGB-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.40 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|