C20H20F3NO4S — CID 155532639
[4-(cyclohexanecarbonylamino)phenyl] 4-(trifluoromethyl)benzenesulfonate (PubChem CID 155532639) has the molecular formula C20H20F3NO4S and a molecular weight of 427.44 g/mol. Its IUPAC name is [4-(cyclohexanecarbonylamino)phenyl] 4-(trifluoromethyl)benzenesulfonate.
| Compound Name | [4-(cyclohexanecarbonylamino)phenyl] 4-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 155532639 |
| Molecular Formula | C20H20F3NO4S |
| Molecular Weight | 427.44 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | [4-(cyclohexanecarbonylamino)phenyl] 4-(trifluoromethyl)benzenesulfonate |
| SMILES | O=C(Nc1ccc(OS(=O)(=O)c2ccc(C(F)(F)F)cc2)cc1)C1CCCCC1 |
| InChI | InChI=1S/C20H20F3NO4S/c21-20(22,23)15-6-12-18(13-7-15)29(26,27)28-17-10-8-16(9-11-17)24-19(25)14-4-2-1-3-5-14/h6-14H,1-5H2,(H,24,25) |
| InChIKey | KGGGULPBWMGDKX-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.44 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|