C23H21F3N2O6S2 — CID 153074122
[4-[[2-methyl-5-[[4-(trifluoromethyl)phenyl]carbamoylamino]phenyl]sulfonylmethyl]phenyl] methanesulfonate (PubChem CID 153074122) has the molecular formula C23H21F3N2O6S2 and a molecular weight of 542.56 g/mol. Its IUPAC name is [4-[[2-methyl-5-[[4-(trifluoromethyl)phenyl]carbamoylamino]phenyl]sulfonylmethyl]phenyl] methanesulfonate.
| Compound Name | [4-[[2-methyl-5-[[4-(trifluoromethyl)phenyl]carbamoylamino]phenyl]sulfonylmethyl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 153074122 |
| Molecular Formula | C23H21F3N2O6S2 |
| Molecular Weight | 542.56 g/mol |
| Exact Mass | 542.08 |
| IUPAC Name | [4-[[2-methyl-5-[[4-(trifluoromethyl)phenyl]carbamoylamino]phenyl]sulfonylmethyl]phenyl] methanesulfonate |
| SMILES | Cc1ccc(NC(=O)Nc2ccc(C(F)(F)F)cc2)cc1S(=O)(=O)Cc1ccc(OS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C23H21F3N2O6S2/c1-15-3-8-19(28-22(29)27-18-9-6-17(7-10-18)23(24,25)26)13-21(15)36(32,33)14-16-4-11-20(12-5-16)34-35(2,30)31/h3-13H,14H2,1-2H3,(H2,27,28,29) |
| InChIKey | VLYGZEDCDRDVPG-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 118.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.56 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|