C21H18ClIN2O3S — CID 161393431
1-[3-[(4-chlorophenyl)methylsulfonyl]-4-methylphenyl]-3-(4-iodophenyl)urea (PubChem CID 161393431) has the molecular formula C21H18ClIN2O3S and a molecular weight of 540.81 g/mol. Its IUPAC name is 1-[3-[(4-chlorophenyl)methylsulfonyl]-4-methylphenyl]-3-(4-iodophenyl)urea.
| Compound Name | 1-[3-[(4-chlorophenyl)methylsulfonyl]-4-methylphenyl]-3-(4-iodophenyl)urea |
|---|---|
| PubChem CID | 161393431 |
| Molecular Formula | C21H18ClIN2O3S |
| Molecular Weight | 540.81 g/mol |
| Exact Mass | 539.98 |
| IUPAC Name | 1-[3-[(4-chlorophenyl)methylsulfonyl]-4-methylphenyl]-3-(4-iodophenyl)urea |
| SMILES | Cc1ccc(NC(=O)Nc2ccc(I)cc2)cc1S(=O)(=O)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H18ClIN2O3S/c1-14-2-9-19(25-21(26)24-18-10-7-17(23)8-11-18)12-20(14)29(27,28)13-15-3-5-16(22)6-4-15/h2-12H,13H2,1H3,(H2,24,25,26) |
| InChIKey | VTHCBJAXBHNSNF-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.81 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|