C27H24Cl2N4O5S2 — CID 90145577
1,3-bis[3-[(4-chlorophenyl)sulfamoyl]-4-methylphenyl]urea (PubChem CID 90145577) has the molecular formula C27H24Cl2N4O5S2 and a molecular weight of 619.55 g/mol. Its IUPAC name is 1,3-bis[3-[(4-chlorophenyl)sulfamoyl]-4-methylphenyl]urea.
| Compound Name | 1,3-bis[3-[(4-chlorophenyl)sulfamoyl]-4-methylphenyl]urea |
|---|---|
| PubChem CID | 90145577 |
| Molecular Formula | C27H24Cl2N4O5S2 |
| Molecular Weight | 619.55 g/mol |
| Exact Mass | 618.06 |
| IUPAC Name | 1,3-bis[3-[(4-chlorophenyl)sulfamoyl]-4-methylphenyl]urea |
| SMILES | Cc1ccc(NC(=O)Nc2ccc(C)c(S(=O)(=O)Nc3ccc(Cl)cc3)c2)cc1S(=O)(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H24Cl2N4O5S2/c1-17-3-9-23(15-25(17)39(35,36)32-21-11-5-19(28)6-12-21)30-27(34)31-24-10-4-18(2)26(16-24)40(37,38)33-22-13-7-20(29)8-14-22/h3-16,32-33H,1-2H3,(H2,30,31,34) |
| InChIKey | UPALHXOXRMEQRS-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 133.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.55 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |