C23H21ClN2O4S — CID 42988703
N-[3-[(4-chlorophenyl)sulfamoyl]-4-methylphenyl]-4-oxo-4-phenylbutanamide (PubChem CID 42988703) has the molecular formula C23H21ClN2O4S and a molecular weight of 456.95 g/mol. Its IUPAC name is N-[3-[(4-chlorophenyl)sulfamoyl]-4-methylphenyl]-4-oxo-4-phenylbutanamide.
| Compound Name | N-[3-[(4-chlorophenyl)sulfamoyl]-4-methylphenyl]-4-oxo-4-phenylbutanamide |
|---|---|
| PubChem CID | 42988703 |
| Molecular Formula | C23H21ClN2O4S |
| Molecular Weight | 456.95 g/mol |
| Exact Mass | 456.09 |
| IUPAC Name | N-[3-[(4-chlorophenyl)sulfamoyl]-4-methylphenyl]-4-oxo-4-phenylbutanamide |
| SMILES | Cc1ccc(NC(=O)CCC(=O)c2ccccc2)cc1S(=O)(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H21ClN2O4S/c1-16-7-10-20(25-23(28)14-13-21(27)17-5-3-2-4-6-17)15-22(16)31(29,30)26-19-11-8-18(24)9-12-19/h2-12,15,26H,13-14H2,1H3,(H,25,28) |
| InChIKey | HTRLWUMJMFFBQN-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.95 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |