C23H21FN2O4S — CID 31474000
N-[3-[(2-fluorophenyl)sulfamoyl]-4-methylphenyl]-4-oxo-4-phenylbutanamide (PubChem CID 31474000) has the molecular formula C23H21FN2O4S and a molecular weight of 440.50 g/mol. Its IUPAC name is N-[3-[(2-fluorophenyl)sulfamoyl]-4-methylphenyl]-4-oxo-4-phenylbutanamide.
| Compound Name | N-[3-[(2-fluorophenyl)sulfamoyl]-4-methylphenyl]-4-oxo-4-phenylbutanamide |
|---|---|
| PubChem CID | 31474000 |
| Molecular Formula | C23H21FN2O4S |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | N-[3-[(2-fluorophenyl)sulfamoyl]-4-methylphenyl]-4-oxo-4-phenylbutanamide |
| SMILES | Cc1ccc(NC(=O)CCC(=O)c2ccccc2)cc1S(=O)(=O)Nc1ccccc1F |
| InChI | InChI=1S/C23H21FN2O4S/c1-16-11-12-18(25-23(28)14-13-21(27)17-7-3-2-4-8-17)15-22(16)31(29,30)26-20-10-6-5-9-19(20)24/h2-12,15,26H,13-14H2,1H3,(H,25,28) |
| InChIKey | XPFDIJBEYCYOAU-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |