C19H16FN3O4S — CID 24648342
N-[3-[(2-fluorophenyl)sulfamoyl]-4-methylphenyl]-6-oxo-1H-pyridine-3-carboxamide (PubChem CID 24648342) has the molecular formula C19H16FN3O4S and a molecular weight of 401.42 g/mol. Its IUPAC name is N-[3-[(2-fluorophenyl)sulfamoyl]-4-methylphenyl]-6-oxo-1H-pyridine-3-carboxamide.
| Compound Name | N-[3-[(2-fluorophenyl)sulfamoyl]-4-methylphenyl]-6-oxo-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 24648342 |
| Molecular Formula | C19H16FN3O4S |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.08 |
| IUPAC Name | N-[3-[(2-fluorophenyl)sulfamoyl]-4-methylphenyl]-6-oxo-1H-pyridine-3-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2ccc(=O)[nH]c2)cc1S(=O)(=O)Nc1ccccc1F |
| InChI | InChI=1S/C19H16FN3O4S/c1-12-6-8-14(22-19(25)13-7-9-18(24)21-11-13)10-17(12)28(26,27)23-16-5-3-2-4-15(16)20/h2-11,23H,1H3,(H,21,24)(H,22,25) |
| InChIKey | KLDRNZWNSJFYGN-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 108.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |