C21H17FN4O3S — CID 4555053
N-[3-[(2-fluorophenyl)sulfamoyl]-4-methylphenyl]-3H-benzimidazole-5-carboxamide (PubChem CID 4555053) has the molecular formula C21H17FN4O3S and a molecular weight of 424.46 g/mol. Its IUPAC name is N-[3-[(2-fluorophenyl)sulfamoyl]-4-methylphenyl]-3H-benzimidazole-5-carboxamide.
| Compound Name | N-[3-[(2-fluorophenyl)sulfamoyl]-4-methylphenyl]-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 4555053 |
| Molecular Formula | C21H17FN4O3S |
| Molecular Weight | 424.46 g/mol |
| Exact Mass | 424.10 |
| IUPAC Name | N-[3-[(2-fluorophenyl)sulfamoyl]-4-methylphenyl]-3H-benzimidazole-5-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2ccc3nc[nH]c3c2)cc1S(=O)(=O)Nc1ccccc1F |
| InChI | InChI=1S/C21H17FN4O3S/c1-13-6-8-15(25-21(27)14-7-9-18-19(10-14)24-12-23-18)11-20(13)30(28,29)26-17-5-3-2-4-16(17)22/h2-12,26H,1H3,(H,23,24)(H,25,27) |
| InChIKey | LVEMBNPYVMBFDP-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.46 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |