C19H16FN3O4S — CID 31474763
N-[3-[(2-fluorophenyl)sulfamoyl]-4-methylphenyl]-1-oxidopyridin-1-ium-4-carboxamide (PubChem CID 31474763) has the molecular formula C19H16FN3O4S and a molecular weight of 401.42 g/mol. Its IUPAC name is N-[3-[(2-fluorophenyl)sulfamoyl]-4-methylphenyl]-1-oxidopyridin-1-ium-4-carboxamide.
| Compound Name | N-[3-[(2-fluorophenyl)sulfamoyl]-4-methylphenyl]-1-oxidopyridin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 31474763 |
| Molecular Formula | C19H16FN3O4S |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.08 |
| IUPAC Name | N-[3-[(2-fluorophenyl)sulfamoyl]-4-methylphenyl]-1-oxidopyridin-1-ium-4-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2cc[n+]([O-])cc2)cc1S(=O)(=O)Nc1ccccc1F |
| InChI | InChI=1S/C19H16FN3O4S/c1-13-6-7-15(21-19(24)14-8-10-23(25)11-9-14)12-18(13)28(26,27)22-17-5-3-2-4-16(17)20/h2-12,22H,1H3,(H,21,24) |
| InChIKey | GZRZPVSSWPEMRL-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 102.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|