C22H28FN3O4S — CID 56520478
N',N'-diethyl-N-[3-[(2-fluorophenyl)sulfamoyl]-4-methylphenyl]pentanediamide (PubChem CID 56520478) has the molecular formula C22H28FN3O4S and a molecular weight of 449.55 g/mol. Its IUPAC name is N',N'-diethyl-N-[3-[(2-fluorophenyl)sulfamoyl]-4-methylphenyl]pentanediamide.
| Compound Name | N',N'-diethyl-N-[3-[(2-fluorophenyl)sulfamoyl]-4-methylphenyl]pentanediamide |
|---|---|
| PubChem CID | 56520478 |
| Molecular Formula | C22H28FN3O4S |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | N',N'-diethyl-N-[3-[(2-fluorophenyl)sulfamoyl]-4-methylphenyl]pentanediamide |
| SMILES | CCN(CC)C(=O)CCCC(=O)Nc1ccc(C)c(S(=O)(=O)Nc2ccccc2F)c1 |
| InChI | InChI=1S/C22H28FN3O4S/c1-4-26(5-2)22(28)12-8-11-21(27)24-17-14-13-16(3)20(15-17)31(29,30)25-19-10-7-6-9-18(19)23/h6-7,9-10,13-15,25H,4-5,8,11-12H2,1-3H3,(H,24,27) |
| InChIKey | KENIANRHHIYCAK-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |