C22H25FN4O5S — CID 24648360
4-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-[3-[(2-fluorophenyl)sulfamoyl]-4-methylphenyl]butanamide (PubChem CID 24648360) has the molecular formula C22H25FN4O5S and a molecular weight of 476.53 g/mol. Its IUPAC name is 4-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-[3-[(2-fluorophenyl)sulfamoyl]-4-methylphenyl]butanamide.
| Compound Name | 4-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-[3-[(2-fluorophenyl)sulfamoyl]-4-methylphenyl]butanamide |
|---|---|
| PubChem CID | 24648360 |
| Molecular Formula | C22H25FN4O5S |
| Molecular Weight | 476.53 g/mol |
| Exact Mass | 476.15 |
| IUPAC Name | 4-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-[3-[(2-fluorophenyl)sulfamoyl]-4-methylphenyl]butanamide |
| SMILES | Cc1ccc(NC(=O)CCCN2C(=O)NC(C)(C)C2=O)cc1S(=O)(=O)Nc1ccccc1F |
| InChI | InChI=1S/C22H25FN4O5S/c1-14-10-11-15(13-18(14)33(31,32)26-17-8-5-4-7-16(17)23)24-19(28)9-6-12-27-20(29)22(2,3)25-21(27)30/h4-5,7-8,10-11,13,26H,6,9,12H2,1-3H3,(H,24,28)(H,25,30) |
| InChIKey | WONSRDLGHDTPDO-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.53 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|