C22H22ClN3O5S — CID 39761071
N-[4-[3-[(4-chlorophenyl)sulfamoyl]-4-methylanilino]-4-oxobutyl]furan-2-carboxamide (PubChem CID 39761071) has the molecular formula C22H22ClN3O5S and a molecular weight of 475.95 g/mol. Its IUPAC name is N-[4-[3-[(4-chlorophenyl)sulfamoyl]-4-methylanilino]-4-oxobutyl]furan-2-carboxamide.
| Compound Name | N-[4-[3-[(4-chlorophenyl)sulfamoyl]-4-methylanilino]-4-oxobutyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 39761071 |
| Molecular Formula | C22H22ClN3O5S |
| Molecular Weight | 475.95 g/mol |
| Exact Mass | 475.10 |
| IUPAC Name | N-[4-[3-[(4-chlorophenyl)sulfamoyl]-4-methylanilino]-4-oxobutyl]furan-2-carboxamide |
| SMILES | Cc1ccc(NC(=O)CCCNC(=O)c2ccco2)cc1S(=O)(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H22ClN3O5S/c1-15-6-9-18(14-20(15)32(29,30)26-17-10-7-16(23)8-11-17)25-21(27)5-2-12-24-22(28)19-4-3-13-31-19/h3-4,6-11,13-14,26H,2,5,12H2,1H3,(H,24,28)(H,25,27) |
| InChIKey | FQNDZLOOHWGRSK-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 117.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.95 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|