C17H18ClN3O4 — CID 31727361
N-[4-[2-[2-(4-chlorophenyl)acetyl]hydrazinyl]-4-oxobutyl]furan-2-carboxamide (PubChem CID 31727361) has the molecular formula C17H18ClN3O4 and a molecular weight of 363.80 g/mol. Its IUPAC name is N-[4-[2-[2-(4-chlorophenyl)acetyl]hydrazinyl]-4-oxobutyl]furan-2-carboxamide.
| Compound Name | N-[4-[2-[2-(4-chlorophenyl)acetyl]hydrazinyl]-4-oxobutyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 31727361 |
| Molecular Formula | C17H18ClN3O4 |
| Molecular Weight | 363.80 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | N-[4-[2-[2-(4-chlorophenyl)acetyl]hydrazinyl]-4-oxobutyl]furan-2-carboxamide |
| SMILES | O=C(CCCNC(=O)c1ccco1)NNC(=O)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H18ClN3O4/c18-13-7-5-12(6-8-13)11-16(23)21-20-15(22)4-1-9-19-17(24)14-3-2-10-25-14/h2-3,5-8,10H,1,4,9,11H2,(H,19,24)(H,20,22)(H,21,23) |
| InChIKey | KMYDDKCUBOAPKL-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 100.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.80 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|