C18H17ClN2O6 — CID 24557874
[2-(furan-2-carbonylamino)-2-oxoethyl] 4-[(4-chlorobenzoyl)amino]butanoate (PubChem CID 24557874) has the molecular formula C18H17ClN2O6 and a molecular weight of 392.80 g/mol. Its IUPAC name is [2-(furan-2-carbonylamino)-2-oxoethyl] 4-[(4-chlorobenzoyl)amino]butanoate.
| Compound Name | [2-(furan-2-carbonylamino)-2-oxoethyl] 4-[(4-chlorobenzoyl)amino]butanoate |
|---|---|
| PubChem CID | 24557874 |
| Molecular Formula | C18H17ClN2O6 |
| Molecular Weight | 392.80 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | [2-(furan-2-carbonylamino)-2-oxoethyl] 4-[(4-chlorobenzoyl)amino]butanoate |
| SMILES | O=C(COC(=O)CCCNC(=O)c1ccc(Cl)cc1)NC(=O)c1ccco1 |
| InChI | InChI=1S/C18H17ClN2O6/c19-13-7-5-12(6-8-13)17(24)20-9-1-4-16(23)27-11-15(22)21-18(25)14-3-2-10-26-14/h2-3,5-8,10H,1,4,9,11H2,(H,20,24)(H,21,22,25) |
| InChIKey | FTDHZAUOYPMYCB-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 114.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.80 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|