C18H18ClN3O6 — CID 7827212
[2-(furan-2-ylmethylcarbamoylamino)-2-oxoethyl] 3-[(4-chlorobenzoyl)amino]propanoate (PubChem CID 7827212) has the molecular formula C18H18ClN3O6 and a molecular weight of 407.81 g/mol. Its IUPAC name is [2-(furan-2-ylmethylcarbamoylamino)-2-oxoethyl] 3-[(4-chlorobenzoyl)amino]propanoate.
| Compound Name | [2-(furan-2-ylmethylcarbamoylamino)-2-oxoethyl] 3-[(4-chlorobenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 7827212 |
| Molecular Formula | C18H18ClN3O6 |
| Molecular Weight | 407.81 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | [2-(furan-2-ylmethylcarbamoylamino)-2-oxoethyl] 3-[(4-chlorobenzoyl)amino]propanoate |
| SMILES | O=C(COC(=O)CCNC(=O)c1ccc(Cl)cc1)NC(=O)NCc1ccco1 |
| InChI | InChI=1S/C18H18ClN3O6/c19-13-5-3-12(4-6-13)17(25)20-8-7-16(24)28-11-15(23)22-18(26)21-10-14-2-1-9-27-14/h1-6,9H,7-8,10-11H2,(H,20,25)(H2,21,22,23,26) |
| InChIKey | MNJVENOXRRHWNR-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 126.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.81 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |