C13H12N2O6 — CID 2631632
[2-(furan-2-ylmethylcarbamoylamino)-2-oxoethyl] furan-2-carboxylate (PubChem CID 2631632) has the molecular formula C13H12N2O6 and a molecular weight of 292.25 g/mol. Its IUPAC name is [2-(furan-2-ylmethylcarbamoylamino)-2-oxoethyl] furan-2-carboxylate.
| Compound Name | [2-(furan-2-ylmethylcarbamoylamino)-2-oxoethyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 2631632 |
| Molecular Formula | C13H12N2O6 |
| Molecular Weight | 292.25 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | [2-(furan-2-ylmethylcarbamoylamino)-2-oxoethyl] furan-2-carboxylate |
| SMILES | O=C(COC(=O)c1ccco1)NC(=O)NCc1ccco1 |
| InChI | InChI=1S/C13H12N2O6/c16-11(8-21-12(17)10-4-2-6-20-10)15-13(18)14-7-9-3-1-5-19-9/h1-6H,7-8H2,(H2,14,15,16,18) |
| InChIKey | HGXWNSARLRGALX-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 110.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.25 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |