C14H11Cl2N3O5 — CID 2485105
[2-(furan-2-ylmethylcarbamoylamino)-2-oxoethyl] 3,6-dichloropyridine-2-carboxylate (PubChem CID 2485105) has the molecular formula C14H11Cl2N3O5 and a molecular weight of 372.16 g/mol. Its IUPAC name is [2-(furan-2-ylmethylcarbamoylamino)-2-oxoethyl] 3,6-dichloropyridine-2-carboxylate.
| Compound Name | [2-(furan-2-ylmethylcarbamoylamino)-2-oxoethyl] 3,6-dichloropyridine-2-carboxylate |
|---|---|
| PubChem CID | 2485105 |
| Molecular Formula | C14H11Cl2N3O5 |
| Molecular Weight | 372.16 g/mol |
| Exact Mass | 371.01 |
| IUPAC Name | [2-(furan-2-ylmethylcarbamoylamino)-2-oxoethyl] 3,6-dichloropyridine-2-carboxylate |
| SMILES | O=C(COC(=O)c1nc(Cl)ccc1Cl)NC(=O)NCc1ccco1 |
| InChI | InChI=1S/C14H11Cl2N3O5/c15-9-3-4-10(16)18-12(9)13(21)24-7-11(20)19-14(22)17-6-8-2-1-5-23-8/h1-5H,6-7H2,(H2,17,19,20,22) |
| InChIKey | DOLGWSQGTFXVCG-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 110.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.16 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|