C15H12BrFN2O5 — CID 8837445
[2-(furan-2-ylmethylcarbamoylamino)-2-oxoethyl] 2-bromo-4-fluorobenzoate (PubChem CID 8837445) has the molecular formula C15H12BrFN2O5 and a molecular weight of 399.17 g/mol. Its IUPAC name is [2-(furan-2-ylmethylcarbamoylamino)-2-oxoethyl] 2-bromo-4-fluorobenzoate.
| Compound Name | [2-(furan-2-ylmethylcarbamoylamino)-2-oxoethyl] 2-bromo-4-fluorobenzoate |
|---|---|
| PubChem CID | 8837445 |
| Molecular Formula | C15H12BrFN2O5 |
| Molecular Weight | 399.17 g/mol |
| Exact Mass | 397.99 |
| IUPAC Name | [2-(furan-2-ylmethylcarbamoylamino)-2-oxoethyl] 2-bromo-4-fluorobenzoate |
| SMILES | O=C(COC(=O)c1ccc(F)cc1Br)NC(=O)NCc1ccco1 |
| InChI | InChI=1S/C15H12BrFN2O5/c16-12-6-9(17)3-4-11(12)14(21)24-8-13(20)19-15(22)18-7-10-2-1-5-23-10/h1-6H,7-8H2,(H2,18,19,20,22) |
| InChIKey | XTLSTRVJVXXIKF-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.17 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |