C11H10BrFN2O4 — CID 40704389
[2-(methylcarbamoylamino)-2-oxoethyl] 2-bromo-4-fluorobenzoate (PubChem CID 40704389) has the molecular formula C11H10BrFN2O4 and a molecular weight of 333.11 g/mol. Its IUPAC name is [2-(methylcarbamoylamino)-2-oxoethyl] 2-bromo-4-fluorobenzoate.
| Compound Name | [2-(methylcarbamoylamino)-2-oxoethyl] 2-bromo-4-fluorobenzoate |
|---|---|
| PubChem CID | 40704389 |
| Molecular Formula | C11H10BrFN2O4 |
| Molecular Weight | 333.11 g/mol |
| Exact Mass | 331.98 |
| IUPAC Name | [2-(methylcarbamoylamino)-2-oxoethyl] 2-bromo-4-fluorobenzoate |
| SMILES | CNC(=O)NC(=O)COC(=O)c1ccc(F)cc1Br |
| InChI | InChI=1S/C11H10BrFN2O4/c1-14-11(18)15-9(16)5-19-10(17)7-3-2-6(13)4-8(7)12/h2-4H,5H2,1H3,(H2,14,15,16,18) |
| InChIKey | KCDRABYTAKYVOY-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.11 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |