C12H12F2N2O4 — CID 2554887
[2-(ethylcarbamoylamino)-2-oxoethyl] 2,4-difluorobenzoate (PubChem CID 2554887) has the molecular formula C12H12F2N2O4 and a molecular weight of 286.23 g/mol. Its IUPAC name is [2-(ethylcarbamoylamino)-2-oxoethyl] 2,4-difluorobenzoate.
| Compound Name | [2-(ethylcarbamoylamino)-2-oxoethyl] 2,4-difluorobenzoate |
|---|---|
| PubChem CID | 2554887 |
| Molecular Formula | C12H12F2N2O4 |
| Molecular Weight | 286.23 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | [2-(ethylcarbamoylamino)-2-oxoethyl] 2,4-difluorobenzoate |
| SMILES | CCNC(=O)NC(=O)COC(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C12H12F2N2O4/c1-2-15-12(19)16-10(17)6-20-11(18)8-4-3-7(13)5-9(8)14/h3-5H,2,6H2,1H3,(H2,15,16,17,19) |
| InChIKey | INBXTUGOSHOAOH-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.23 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |