C12H13FN2O4 — CID 2511496
[2-(ethylcarbamoylamino)-2-oxoethyl] 2-fluorobenzoate (PubChem CID 2511496) has the molecular formula C12H13FN2O4 and a molecular weight of 268.24 g/mol. Its IUPAC name is [2-(ethylcarbamoylamino)-2-oxoethyl] 2-fluorobenzoate.
| Compound Name | [2-(ethylcarbamoylamino)-2-oxoethyl] 2-fluorobenzoate |
|---|---|
| PubChem CID | 2511496 |
| Molecular Formula | C12H13FN2O4 |
| Molecular Weight | 268.24 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | [2-(ethylcarbamoylamino)-2-oxoethyl] 2-fluorobenzoate |
| SMILES | CCNC(=O)NC(=O)COC(=O)c1ccccc1F |
| InChI | InChI=1S/C12H13FN2O4/c1-2-14-12(18)15-10(16)7-19-11(17)8-5-3-4-6-9(8)13/h3-6H,2,7H2,1H3,(H2,14,15,16,18) |
| InChIKey | WAXRFUSZAFCOJG-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.24 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |