C13H15N3O6 — CID 2564448
[2-(ethylcarbamoylamino)-2-oxoethyl] 2-methyl-3-nitrobenzoate (PubChem CID 2564448) has the molecular formula C13H15N3O6 and a molecular weight of 309.28 g/mol. Its IUPAC name is [2-(ethylcarbamoylamino)-2-oxoethyl] 2-methyl-3-nitrobenzoate.
| Compound Name | [2-(ethylcarbamoylamino)-2-oxoethyl] 2-methyl-3-nitrobenzoate |
|---|---|
| PubChem CID | 2564448 |
| Molecular Formula | C13H15N3O6 |
| Molecular Weight | 309.28 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | [2-(ethylcarbamoylamino)-2-oxoethyl] 2-methyl-3-nitrobenzoate |
| SMILES | CCNC(=O)NC(=O)COC(=O)c1cccc([N+](=O)[O-])c1C |
| InChI | InChI=1S/C13H15N3O6/c1-3-14-13(19)15-11(17)7-22-12(18)9-5-4-6-10(8(9)2)16(20)21/h4-6H,3,7H2,1-2H3,(H2,14,15,17,19) |
| InChIKey | QKNFGVUGWQQRMT-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.28 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|