C17H14ClN3O6 — CID 2564378
[2-[2-(4-chlorobenzoyl)hydrazinyl]-2-oxoethyl] 2-methyl-3-nitrobenzoate (PubChem CID 2564378) has the molecular formula C17H14ClN3O6 and a molecular weight of 391.77 g/mol. Its IUPAC name is [2-[2-(4-chlorobenzoyl)hydrazinyl]-2-oxoethyl] 2-methyl-3-nitrobenzoate.
| Compound Name | [2-[2-(4-chlorobenzoyl)hydrazinyl]-2-oxoethyl] 2-methyl-3-nitrobenzoate |
|---|---|
| PubChem CID | 2564378 |
| Molecular Formula | C17H14ClN3O6 |
| Molecular Weight | 391.77 g/mol |
| Exact Mass | 391.06 |
| IUPAC Name | [2-[2-(4-chlorobenzoyl)hydrazinyl]-2-oxoethyl] 2-methyl-3-nitrobenzoate |
| SMILES | Cc1c(C(=O)OCC(=O)NNC(=O)c2ccc(Cl)cc2)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H14ClN3O6/c1-10-13(3-2-4-14(10)21(25)26)17(24)27-9-15(22)19-20-16(23)11-5-7-12(18)8-6-11/h2-8H,9H2,1H3,(H,19,22)(H,20,23) |
| InChIKey | KVEVREAPPSKHCI-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.77 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|