C17H14ClN3O7 — CID 7864396
[2-[2-(5-chloro-2-methoxybenzoyl)hydrazinyl]-2-oxoethyl] 2-nitrobenzoate (PubChem CID 7864396) has the molecular formula C17H14ClN3O7 and a molecular weight of 407.77 g/mol. Its IUPAC name is [2-[2-(5-chloro-2-methoxybenzoyl)hydrazinyl]-2-oxoethyl] 2-nitrobenzoate.
| Compound Name | [2-[2-(5-chloro-2-methoxybenzoyl)hydrazinyl]-2-oxoethyl] 2-nitrobenzoate |
|---|---|
| PubChem CID | 7864396 |
| Molecular Formula | C17H14ClN3O7 |
| Molecular Weight | 407.77 g/mol |
| Exact Mass | 407.05 |
| IUPAC Name | [2-[2-(5-chloro-2-methoxybenzoyl)hydrazinyl]-2-oxoethyl] 2-nitrobenzoate |
| SMILES | COc1ccc(Cl)cc1C(=O)NNC(=O)COC(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H14ClN3O7/c1-27-14-7-6-10(18)8-12(14)16(23)20-19-15(22)9-28-17(24)11-4-2-3-5-13(11)21(25)26/h2-8H,9H2,1H3,(H,19,22)(H,20,23) |
| InChIKey | QPFVUHZRXHEGAP-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 136.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.77 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|