C18H17ClN4O7 — CID 24636081
N-[2-[2-(5-chloro-2-methoxybenzoyl)hydrazinyl]-2-oxoethyl]-4-methoxy-3-nitrobenzamide (PubChem CID 24636081) has the molecular formula C18H17ClN4O7 and a molecular weight of 436.81 g/mol. Its IUPAC name is N-[2-[2-(5-chloro-2-methoxybenzoyl)hydrazinyl]-2-oxoethyl]-4-methoxy-3-nitrobenzamide.
| Compound Name | N-[2-[2-(5-chloro-2-methoxybenzoyl)hydrazinyl]-2-oxoethyl]-4-methoxy-3-nitrobenzamide |
|---|---|
| PubChem CID | 24636081 |
| Molecular Formula | C18H17ClN4O7 |
| Molecular Weight | 436.81 g/mol |
| Exact Mass | 436.08 |
| IUPAC Name | N-[2-[2-(5-chloro-2-methoxybenzoyl)hydrazinyl]-2-oxoethyl]-4-methoxy-3-nitrobenzamide |
| SMILES | COc1ccc(Cl)cc1C(=O)NNC(=O)CNC(=O)c1ccc(OC)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H17ClN4O7/c1-29-14-6-4-11(19)8-12(14)18(26)22-21-16(24)9-20-17(25)10-3-5-15(30-2)13(7-10)23(27)28/h3-8H,9H2,1-2H3,(H,20,25)(H,21,24)(H,22,26) |
| InChIKey | NNBYQVTUVRVZTC-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 148.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.81 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|