C16H14ClN3O5S — CID 2125835
5-chloro-2-methoxy-N'-[2-(4-nitrophenyl)sulfanylacetyl]benzohydrazide (PubChem CID 2125835) has the molecular formula C16H14ClN3O5S and a molecular weight of 395.82 g/mol. Its IUPAC name is 5-chloro-2-methoxy-N'-[2-(4-nitrophenyl)sulfanylacetyl]benzohydrazide.
| Compound Name | 5-chloro-2-methoxy-N'-[2-(4-nitrophenyl)sulfanylacetyl]benzohydrazide |
|---|---|
| PubChem CID | 2125835 |
| Molecular Formula | C16H14ClN3O5S |
| Molecular Weight | 395.82 g/mol |
| Exact Mass | 395.03 |
| IUPAC Name | 5-chloro-2-methoxy-N'-[2-(4-nitrophenyl)sulfanylacetyl]benzohydrazide |
| SMILES | COc1ccc(Cl)cc1C(=O)NNC(=O)CSc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H14ClN3O5S/c1-25-14-7-2-10(17)8-13(14)16(22)19-18-15(21)9-26-12-5-3-11(4-6-12)20(23)24/h2-8H,9H2,1H3,(H,18,21)(H,19,22) |
| InChIKey | MZKMZSOZIGVFLT-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.82 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|