C17H15ClN4O6 — CID 18159278
N-[2-[2-(5-chloro-2-methoxybenzoyl)hydrazinyl]-2-oxoethyl]-3-nitrobenzamide (PubChem CID 18159278) has the molecular formula C17H15ClN4O6 and a molecular weight of 406.78 g/mol. Its IUPAC name is N-[2-[2-(5-chloro-2-methoxybenzoyl)hydrazinyl]-2-oxoethyl]-3-nitrobenzamide.
| Compound Name | N-[2-[2-(5-chloro-2-methoxybenzoyl)hydrazinyl]-2-oxoethyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 18159278 |
| Molecular Formula | C17H15ClN4O6 |
| Molecular Weight | 406.78 g/mol |
| Exact Mass | 406.07 |
| IUPAC Name | N-[2-[2-(5-chloro-2-methoxybenzoyl)hydrazinyl]-2-oxoethyl]-3-nitrobenzamide |
| SMILES | COc1ccc(Cl)cc1C(=O)NNC(=O)CNC(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H15ClN4O6/c1-28-14-6-5-11(18)8-13(14)17(25)21-20-15(23)9-19-16(24)10-3-2-4-12(7-10)22(26)27/h2-8H,9H2,1H3,(H,19,24)(H,20,23)(H,21,25) |
| InChIKey | HKZNEPCMXVGKCU-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 139.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.78 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|