C19H17N5O5 — CID 24554224
N-[2-[2-(1-methylindole-3-carbonyl)hydrazinyl]-2-oxoethyl]-3-nitrobenzamide (PubChem CID 24554224) has the molecular formula C19H17N5O5 and a molecular weight of 395.38 g/mol. Its IUPAC name is N-[2-[2-(1-methylindole-3-carbonyl)hydrazinyl]-2-oxoethyl]-3-nitrobenzamide.
| Compound Name | N-[2-[2-(1-methylindole-3-carbonyl)hydrazinyl]-2-oxoethyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 24554224 |
| Molecular Formula | C19H17N5O5 |
| Molecular Weight | 395.38 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | N-[2-[2-(1-methylindole-3-carbonyl)hydrazinyl]-2-oxoethyl]-3-nitrobenzamide |
| SMILES | Cn1cc(C(=O)NNC(=O)CNC(=O)c2cccc([N+](=O)[O-])c2)c2ccccc21 |
| InChI | InChI=1S/C19H17N5O5/c1-23-11-15(14-7-2-3-8-16(14)23)19(27)22-21-17(25)10-20-18(26)12-5-4-6-13(9-12)24(28)29/h2-9,11H,10H2,1H3,(H,20,26)(H,21,25)(H,22,27) |
| InChIKey | XXMXYWUQZYHPIT-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 135.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.38 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|