C14H11BrN4O6 — CID 27662850
5-bromo-N-[2-[2-(3-nitrobenzoyl)hydrazinyl]-2-oxoethyl]furan-2-carboxamide (PubChem CID 27662850) has the molecular formula C14H11BrN4O6 and a molecular weight of 411.17 g/mol. Its IUPAC name is 5-bromo-N-[2-[2-(3-nitrobenzoyl)hydrazinyl]-2-oxoethyl]furan-2-carboxamide.
| Compound Name | 5-bromo-N-[2-[2-(3-nitrobenzoyl)hydrazinyl]-2-oxoethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 27662850 |
| Molecular Formula | C14H11BrN4O6 |
| Molecular Weight | 411.17 g/mol |
| Exact Mass | 409.99 |
| IUPAC Name | 5-bromo-N-[2-[2-(3-nitrobenzoyl)hydrazinyl]-2-oxoethyl]furan-2-carboxamide |
| SMILES | O=C(CNC(=O)c1ccc(Br)o1)NNC(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H11BrN4O6/c15-11-5-4-10(25-11)14(22)16-7-12(20)17-18-13(21)8-2-1-3-9(6-8)19(23)24/h1-6H,7H2,(H,16,22)(H,17,20)(H,18,21) |
| InChIKey | DICQLDWHQLGAQK-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 143.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.17 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|