C10H11N5O5 — CID 18168702
[2-[2-(3-nitrobenzoyl)hydrazinyl]-2-oxoethyl]urea (PubChem CID 18168702) has the molecular formula C10H11N5O5 and a molecular weight of 281.23 g/mol. Its IUPAC name is [2-[2-(3-nitrobenzoyl)hydrazinyl]-2-oxoethyl]urea.
| Compound Name | [2-[2-(3-nitrobenzoyl)hydrazinyl]-2-oxoethyl]urea |
|---|---|
| PubChem CID | 18168702 |
| Molecular Formula | C10H11N5O5 |
| Molecular Weight | 281.23 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | [2-[2-(3-nitrobenzoyl)hydrazinyl]-2-oxoethyl]urea |
| SMILES | NC(=O)NCC(=O)NNC(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C10H11N5O5/c11-10(18)12-5-8(16)13-14-9(17)6-2-1-3-7(4-6)15(19)20/h1-4H,5H2,(H,13,16)(H,14,17)(H3,11,12,18) |
| InChIKey | JGNTWWXLIBWORL-UHFFFAOYSA-N |
| XLogP | -0.98 |
| TPSA | 156.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.23 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|