C15H15N3O7 — CID 100610624
5-(dimethoxymethyl)-N'-(3-nitrobenzoyl)furan-2-carbohydrazide (PubChem CID 100610624) has the molecular formula C15H15N3O7 and a molecular weight of 349.30 g/mol. Its IUPAC name is 5-(dimethoxymethyl)-N'-(3-nitrobenzoyl)furan-2-carbohydrazide.
| Compound Name | 5-(dimethoxymethyl)-N'-(3-nitrobenzoyl)furan-2-carbohydrazide |
|---|---|
| PubChem CID | 100610624 |
| Molecular Formula | C15H15N3O7 |
| Molecular Weight | 349.30 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | 5-(dimethoxymethyl)-N'-(3-nitrobenzoyl)furan-2-carbohydrazide |
| SMILES | COC(OC)c1ccc(C(=O)NNC(=O)c2cccc([N+](=O)[O-])c2)o1 |
| InChI | InChI=1S/C15H15N3O7/c1-23-15(24-2)12-7-6-11(25-12)14(20)17-16-13(19)9-4-3-5-10(8-9)18(21)22/h3-8,15H,1-2H3,(H,16,19)(H,17,20) |
| InChIKey | MAAUBXUTLCCKNA-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 132.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.30 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|