About 5-(2-fluorophenyl)-N'-(3-nitrobenzoyl)furan-2-carbohydrazide
5-(2-fluorophenyl)-N'-(3-nitrobenzoyl)furan-2-carbohydrazide (PubChem CID 9402087) has the molecular formula C18H12FN3O5
and a molecular weight of 369.31 g/mol. Its IUPAC name is 5-(2-fluorophenyl)-N'-(3-nitrobenzoyl)furan-2-carbohydrazide.
Molecular Properties
| Compound Name | 5-(2-fluorophenyl)-N'-(3-nitrobenzoyl)furan-2-carbohydrazide |
| PubChem CID | 9402087 |
| Molecular Formula | C18H12FN3O5 |
| Molecular Weight | 369.31 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | 5-(2-fluorophenyl)-N'-(3-nitrobenzoyl)furan-2-carbohydrazide |
| SMILES | O=C(NNC(=O)c1ccc(-c2ccccc2F)o1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H12FN3O5/c19-14-7-2-1-6-13(14)15-8-9-16(27-15)18(24)21-20-17(23)11-4-3-5-12(10-11)22(25)26/h1-10H,(H,20,23)(H,21,24) |
| InChIKey | MHWHPWFCTVMOFE-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.31 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-(2-fluorophenyl)-N'-(3-nitrobenzoyl)furan-2-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-fluorophenyl)-N'-(3-nitrobenzoyl)furan-2-carbohydrazide?
The IUPAC name of 5-(2-fluorophenyl)-N'-(3-nitrobenzoyl)furan-2-carbohydrazide (CID 9402087) is 5-(2-fluorophenyl)-N'-(3-nitrobenzoyl)furan-2-carbohydrazide.
What is the SMILES notation for 5-(2-fluorophenyl)-N'-(3-nitrobenzoyl)furan-2-carbohydrazide?
The canonical SMILES for 5-(2-fluorophenyl)-N'-(3-nitrobenzoyl)furan-2-carbohydrazide is O=C(NNC(=O)c1ccc(-c2ccccc2F)o1)c1cccc([N+](=O)[O-])c1.
What is the InChIKey of 5-(2-fluorophenyl)-N'-(3-nitrobenzoyl)furan-2-carbohydrazide?
The InChIKey is MHWHPWFCTVMOFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12FN3O5/c19-14-7-2-1-6-13(14)15-8-9-16(27-15)18(24)21-20-17(23)11-4-3-5-12(10-11)22(25)26/h1-10H,(H,20,23)(H,21,24).
What are the key properties of 5-(2-fluorophenyl)-N'-(3-nitrobenzoyl)furan-2-carbohydrazide?
5-(2-fluorophenyl)-N'-(3-nitrobenzoyl)furan-2-carbohydrazide has a molecular weight of 369.31 g/mol, XLogP of 3.07, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-fluorophenyl)-N'-(3-nitrobenzoyl)furan-2-carbohydrazide is sourced from PubChem (CID 9402087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).