C23H16N4O6 — CID 55334448
3-[(1,3-dioxoisoindol-2-yl)methyl]-N'-(3-nitrobenzoyl)benzohydrazide (PubChem CID 55334448) has the molecular formula C23H16N4O6 and a molecular weight of 444.40 g/mol. Its IUPAC name is 3-[(1,3-dioxoisoindol-2-yl)methyl]-N'-(3-nitrobenzoyl)benzohydrazide.
| Compound Name | 3-[(1,3-dioxoisoindol-2-yl)methyl]-N'-(3-nitrobenzoyl)benzohydrazide |
|---|---|
| PubChem CID | 55334448 |
| Molecular Formula | C23H16N4O6 |
| Molecular Weight | 444.40 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | 3-[(1,3-dioxoisoindol-2-yl)methyl]-N'-(3-nitrobenzoyl)benzohydrazide |
| SMILES | O=C(NNC(=O)c1cccc([N+](=O)[O-])c1)c1cccc(CN2C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C23H16N4O6/c28-20(24-25-21(29)16-7-4-8-17(12-16)27(32)33)15-6-3-5-14(11-15)13-26-22(30)18-9-1-2-10-19(18)23(26)31/h1-12H,13H2,(H,24,28)(H,25,29) |
| InChIKey | OPEMZWPFIHYGAT-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 138.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.40 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|