C28H20N2O3 — CID 51548115
3-[(1,3-dioxoisoindol-2-yl)methyl]-N-(2-phenylphenyl)benzamide (PubChem CID 51548115) has the molecular formula C28H20N2O3 and a molecular weight of 432.48 g/mol. Its IUPAC name is 3-[(1,3-dioxoisoindol-2-yl)methyl]-N-(2-phenylphenyl)benzamide.
| Compound Name | 3-[(1,3-dioxoisoindol-2-yl)methyl]-N-(2-phenylphenyl)benzamide |
|---|---|
| PubChem CID | 51548115 |
| Molecular Formula | C28H20N2O3 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | 3-[(1,3-dioxoisoindol-2-yl)methyl]-N-(2-phenylphenyl)benzamide |
| SMILES | O=C(Nc1ccccc1-c1ccccc1)c1cccc(CN2C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C28H20N2O3/c31-26(29-25-16-7-6-13-22(25)20-10-2-1-3-11-20)21-12-8-9-19(17-21)18-30-27(32)23-14-4-5-15-24(23)28(30)33/h1-17H,18H2,(H,29,31) |
| InChIKey | IDXBRTZTQJUESF-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|