C26H23N3O4 — CID 46543344
2-[[3-[(1,3-dioxoisoindol-2-yl)methyl]benzoyl]amino]-N-propylbenzamide (PubChem CID 46543344) has the molecular formula C26H23N3O4 and a molecular weight of 441.49 g/mol. Its IUPAC name is 2-[[3-[(1,3-dioxoisoindol-2-yl)methyl]benzoyl]amino]-N-propylbenzamide.
| Compound Name | 2-[[3-[(1,3-dioxoisoindol-2-yl)methyl]benzoyl]amino]-N-propylbenzamide |
|---|---|
| PubChem CID | 46543344 |
| Molecular Formula | C26H23N3O4 |
| Molecular Weight | 441.49 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | 2-[[3-[(1,3-dioxoisoindol-2-yl)methyl]benzoyl]amino]-N-propylbenzamide |
| SMILES | CCCNC(=O)c1ccccc1NC(=O)c1cccc(CN2C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C26H23N3O4/c1-2-14-27-24(31)21-12-5-6-13-22(21)28-23(30)18-9-7-8-17(15-18)16-29-25(32)19-10-3-4-11-20(19)26(29)33/h3-13,15H,2,14,16H2,1H3,(H,27,31)(H,28,30) |
| InChIKey | LIXNNGZFZIXDIQ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.49 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|