C26H21N3O4 — CID 34281206
2-benzyl-N-[2-(cyclopropylcarbamoyl)phenyl]-1,3-dioxoisoindole-5-carboxamide (PubChem CID 34281206) has the molecular formula C26H21N3O4 and a molecular weight of 439.47 g/mol. Its IUPAC name is 2-benzyl-N-[2-(cyclopropylcarbamoyl)phenyl]-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | 2-benzyl-N-[2-(cyclopropylcarbamoyl)phenyl]-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 34281206 |
| Molecular Formula | C26H21N3O4 |
| Molecular Weight | 439.47 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | 2-benzyl-N-[2-(cyclopropylcarbamoyl)phenyl]-1,3-dioxoisoindole-5-carboxamide |
| SMILES | O=C(Nc1ccccc1C(=O)NC1CC1)c1ccc2c(c1)C(=O)N(Cc1ccccc1)C2=O |
| InChI | InChI=1S/C26H21N3O4/c30-23(28-22-9-5-4-8-20(22)24(31)27-18-11-12-18)17-10-13-19-21(14-17)26(33)29(25(19)32)15-16-6-2-1-3-7-16/h1-10,13-14,18H,11-12,15H2,(H,27,31)(H,28,30) |
| InChIKey | PGBVGNNWUFVVMF-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.47 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|