C24H20N2O2S — CID 5142419
5-benzyl-N-cyclopropyl-6-oxobenzo[b][1,4]benzothiazepine-3-carboxamide (PubChem CID 5142419) has the molecular formula C24H20N2O2S and a molecular weight of 400.50 g/mol. Its IUPAC name is 5-benzyl-N-cyclopropyl-6-oxobenzo[b][1,4]benzothiazepine-3-carboxamide.
| Compound Name | 5-benzyl-N-cyclopropyl-6-oxobenzo[b][1,4]benzothiazepine-3-carboxamide |
|---|---|
| PubChem CID | 5142419 |
| Molecular Formula | C24H20N2O2S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | 5-benzyl-N-cyclopropyl-6-oxobenzo[b][1,4]benzothiazepine-3-carboxamide |
| SMILES | O=C(NC1CC1)c1ccc2c(c1)N(Cc1ccccc1)C(=O)c1ccccc1S2 |
| InChI | InChI=1S/C24H20N2O2S/c27-23(25-18-11-12-18)17-10-13-22-20(14-17)26(15-16-6-2-1-3-7-16)24(28)19-8-4-5-9-21(19)29-22/h1-10,13-14,18H,11-12,15H2,(H,25,27) |
| InChIKey | MJLDRFBYJLYRML-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |