C25H28N2O2S — CID 4097900
N-cyclooctyl-6-oxo-5-prop-2-enylbenzo[b][1,4]benzothiazepine-3-carboxamide (PubChem CID 4097900) has the molecular formula C25H28N2O2S and a molecular weight of 420.58 g/mol. Its IUPAC name is N-cyclooctyl-6-oxo-5-prop-2-enylbenzo[b][1,4]benzothiazepine-3-carboxamide.
| Compound Name | N-cyclooctyl-6-oxo-5-prop-2-enylbenzo[b][1,4]benzothiazepine-3-carboxamide |
|---|---|
| PubChem CID | 4097900 |
| Molecular Formula | C25H28N2O2S |
| Molecular Weight | 420.58 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | N-cyclooctyl-6-oxo-5-prop-2-enylbenzo[b][1,4]benzothiazepine-3-carboxamide |
| SMILES | C=CCN1C(=O)c2ccccc2Sc2ccc(C(=O)NC3CCCCCCC3)cc21 |
| InChI | InChI=1S/C25H28N2O2S/c1-2-16-27-21-17-18(24(28)26-19-10-6-4-3-5-7-11-19)14-15-23(21)30-22-13-9-8-12-20(22)25(27)29/h2,8-9,12-15,17,19H,1,3-7,10-11,16H2,(H,26,28) |
| InChIKey | AWELAJPPBQIOFT-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.58 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|